cas: 1003298-85-8 — see every product listed under this CAS number, including other names
(4-(Benzyloxy)-3,5-dichlorophenyl)boronic acid (CAS 1003298-85-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219043-1G |
| cas | 1003298-85-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 940.31 Pln | |
| Fluorochem | 5g | 2663.66 Pln |
| delivery time | 3-4 weeks |
|---|
(3,5-dichloro-4-phenylmethoxyphenyl)boronic acid (CAS 1003298-85-8) is a chemical compound with the molecular formula C13H11BCl2O3 and a molecular weight of 296.9 g/mol. IUPAC name: (3,5-dichloro-4-phenylmethoxyphenyl)boronic acid. InChIKey: BAXPPGSWZDNMOG-UHFFFAOYSA-N.
| Molecular formula | C13H11BCl2O3 |
|---|---|
| Molecular weight | 296.9 g/mol |
| IUPAC name | (3,5-dichloro-4-phenylmethoxyphenyl)boronic acid |
| InChIKey | BAXPPGSWZDNMOG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)OCC2=CC=CC=C2)Cl)(O)O |
Computed by PubChem (NCBI)