cas: 860701-53-7 — see every product listed under this CAS number, including other names
(4-(Isopropylsulfonyl)phenyl)methanamine hydrochloride, 98% (CAS 860701-53-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g, 2.5g. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A1736538-5g |
| cas | 860701-53-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 28505.68 Pln | |
| Fluorochem | 100mg | 1684.84 Pln | |
| Fluorochem | 250mg | 2387.72 Pln | |
| Fluorochem | 500mg | 3684.14 Pln | |
| Fluorochem | 1g | 4709.82 Pln | |
| Fluorochem | 2.5g | 8994.77 Pln | |
| Fluorochem | 5g | 13284.92 Pln | |
| Chemat | 100mg | 1331.60 Pln | |
| Chemat | 250mg | 1874.00 Pln | |
| Chemat | 1g | 3712.40 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(4-propan-2-ylsulfonylphenyl)methanamine;hydrochloride (CAS 860701-53-7) is a chemical compound with the molecular formula C10H16ClNO2S and a molecular weight of 249.76 g/mol. IUPAC name: (4-propan-2-ylsulfonylphenyl)methanamine;hydrochloride. InChIKey: MZHLIIROGPOGOA-UHFFFAOYSA-N.
| Molecular formula | C10H16ClNO2S |
|---|---|
| Molecular weight | 249.76 g/mol |
| IUPAC name | (4-propan-2-ylsulfonylphenyl)methanamine;hydrochloride |
| InChIKey | MZHLIIROGPOGOA-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)C1=CC=C(C=C1)CN.Cl |
Computed by PubChem (NCBI)