cas: 870459-90-8 — see every product listed under this CAS number, including other names
(4-(Trifluoromethyl)pyridin-2-yl)boronic acid, 95% (CAS 870459-90-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F238575-100MG |
| cas | 870459-90-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 424.87 Pln | |
| Fluorochem | 250mg | 674.78 Pln | |
| Fluorochem | 1g | 1783.76 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[4-(trifluoromethyl)-2-pyridinyl]boronic acid (CAS 870459-90-8) is a chemical compound with the molecular formula C6H5BF3NO2 and a molecular weight of 190.92 g/mol. IUPAC name: [4-(trifluoromethyl)-2-pyridinyl]boronic acid. InChIKey: KJFNGXQZOZOTHA-UHFFFAOYSA-N.
| Molecular formula | C6H5BF3NO2 |
|---|---|
| Molecular weight | 190.92 g/mol |
| IUPAC name | [4-(trifluoromethyl)-2-pyridinyl]boronic acid |
| InChIKey | KJFNGXQZOZOTHA-UHFFFAOYSA-N |
| SMILES | B(C1=NC=CC(=C1)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)