cas: 1027045-31-3 — see every product listed under this CAS number, including other names
(4-Chloro-2,6-dimethylphenyl)boronic acid, 97% (CAS 1027045-31-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F228403-250MG |
| cas | 1027045-31-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 737.26 Pln | |
| Fluorochem | 5g | 2189.87 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(4-chloro-2,6-dimethylphenyl)boronic acid (CAS 1027045-31-3) is a chemical compound with the molecular formula C8H10BClO2 and a molecular weight of 184.43 g/mol. IUPAC name: (4-chloro-2,6-dimethylphenyl)boronic acid. InChIKey: FVASMUNXBUYNIX-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO2 |
|---|---|
| Molecular weight | 184.43 g/mol |
| IUPAC name | (4-chloro-2,6-dimethylphenyl)boronic acid |
| InChIKey | FVASMUNXBUYNIX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)Cl)C)(O)O |
Computed by PubChem (NCBI)