cas: 1027045-31-3 — see every product listed under this CAS number, including other names
2,6-Dimethyl-4-chlorophenylboronic acid, 98%, 98% (CAS 1027045-31-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11196Y-100mg |
| cas | 1027045-31-3 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 554.00 Pln | |
| Chemat | 5g | 1787.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-chloro-2,6-dimethylphenyl)boronic acid (CAS 1027045-31-3) is a chemical compound with the molecular formula C8H10BClO2 and a molecular weight of 184.43 g/mol. IUPAC name: (4-chloro-2,6-dimethylphenyl)boronic acid. InChIKey: FVASMUNXBUYNIX-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO2 |
|---|---|
| Molecular weight | 184.43 g/mol |
| IUPAC name | (4-chloro-2,6-dimethylphenyl)boronic acid |
| InChIKey | FVASMUNXBUYNIX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)Cl)C)(O)O |
Computed by PubChem (NCBI)