(4-Chloro-2-fluoro-3-methylphenyl)boronic acid 98%
cas: 944128-92-1 — see every product listed under this CAS number, including other names
(4-Chloro-2-fluoro-3-methylphenyl)boronic acid 98% (CAS 944128-92-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A309206-250mg |
| cas | 944128-92-1 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 893.25 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A309206 |
(4-chloro-2-fluoro-3-methylphenyl)boronic acid (CAS 944128-92-1) is a chemical compound with the molecular formula C7H7BClFO2 and a molecular weight of 188.39 g/mol. IUPAC name: (4-chloro-2-fluoro-3-methylphenyl)boronic acid. InChIKey: GEQUDJQVXRZIIK-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO2 |
|---|---|
| Molecular weight | 188.39 g/mol |
| IUPAC name | (4-chloro-2-fluoro-3-methylphenyl)boronic acid |
| InChIKey | GEQUDJQVXRZIIK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Cl)C)F)(O)O |
Computed by PubChem (NCBI)