cas: 14440-47-2 — see every product listed under this CAS number, including other names
(4-Chloro-2-formylphenoxy)acetic acid, 95% (CAS 14440-47-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 250mg, 50mg, 100mg, 500mg, 2.5g, 10g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | JE-0835-5g |
| cas | 14440-47-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 50mg | 247.85 Pln | |
| Fluorochem | 100mg | 299.91 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 500mg | 581.06 Pln | |
| Fluorochem | 1g | 763.29 Pln | |
| Fluorochem | 2.5g | 1825.42 Pln | |
| Fluorochem | 5g | 2580.36 Pln | |
| Fluorochem | 10g | 3845.54 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-(4-chloro-2-formylphenoxy)acetic acid (CAS 14440-47-2) is a chemical compound with the molecular formula C9H7ClO4 and a molecular weight of 214.60 g/mol. IUPAC name: 2-(4-chloro-2-formylphenoxy)acetic acid. InChIKey: VXVIICNFYDEOJG-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO4 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | 2-(4-chloro-2-formylphenoxy)acetic acid |
| InChIKey | VXVIICNFYDEOJG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C=O)OCC(=O)O |
Computed by PubChem (NCBI)