cas: 6640-25-1 — see every product listed under this CAS number, including other names
(4-Chlorophenyl)(cyclopropyl)methanone, 98%, 98% (CAS 6640-25-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114L8V-1g |
| cas | 6640-25-1 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 141.20 Pln | |
| Chemat | 25g | 246.80 Pln | |
| Chemat | 100g | 794.00 Pln | |
| Chemat | 500g | 3787.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-chlorophenyl)-cyclopropylmethanone (CAS 6640-25-1) is a chemical compound with the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. IUPAC name: (4-chlorophenyl)-cyclopropylmethanone. InChIKey: OPSFCTBBDIDFJM-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | (4-chlorophenyl)-cyclopropylmethanone |
| InChIKey | OPSFCTBBDIDFJM-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)