cas: 6640-25-1 — see every product listed under this CAS number, including other names
4-chlorophenyl cyclopropyl ketone, 98% (CAS 6640-25-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F204028-5G |
| cas | 6640-25-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 143.72 Pln | |
| Fluorochem | 25g | 414.46 Pln | |
| Fluorochem | 100g | 1393.28 Pln | |
| Fluorochem | 500g | 5069.07 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(4-chlorophenyl)-cyclopropylmethanone (CAS 6640-25-1) is a chemical compound with the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. IUPAC name: (4-chlorophenyl)-cyclopropylmethanone. InChIKey: OPSFCTBBDIDFJM-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | (4-chlorophenyl)-cyclopropylmethanone |
| InChIKey | OPSFCTBBDIDFJM-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)