(4-Fluoro-2-isopropoxyphenyl)boronic acid, 97%, 97%
cas: 480438-59-3 — see every product listed under this CAS number, including other names
(4-Fluoro-2-isopropoxyphenyl)boronic acid, 97%, 97% (CAS 480438-59-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117Y5D-100mg |
| cas | 480438-59-3 |
| size | 100mg |
| availability | 60g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 587.60 Pln | |
| Chemat | 10g | 1010.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(4-fluoro-2-propan-2-yloxyphenyl)boronic acid (CAS 480438-59-3) is a chemical compound with the molecular formula C9H12BFO3 and a molecular weight of 198.00 g/mol. IUPAC name: (4-fluoro-2-propan-2-yloxyphenyl)boronic acid. InChIKey: RSEFJQODCQCGRB-UHFFFAOYSA-N.
| Molecular formula | C9H12BFO3 |
|---|---|
| Molecular weight | 198.00 g/mol |
| IUPAC name | (4-fluoro-2-propan-2-yloxyphenyl)boronic acid |
| InChIKey | RSEFJQODCQCGRB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)F)OC(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Fluoro-2-isopropoxyphenylboronic acid, (4-Fluoro-2-isopropoxyphenyl)boronic acid, (4-fluoro-2-propan-2-yloxyphenyl)boronic acid, (4-Fluoro-2-isopropoxy-phenyl)boronic acid, (4-Fluoro-2-isopropoxyphenyl)boronicacid, RSEFJQODCQCGRB-UHFFFAOYSA-N, 4-fluoro-2-isopropoxybenzene boronic acid, {4-Fluoro-2-[(propan-2-yl)oxy]phenyl}boronic acid, B-[4-Fluoro-2-(1-methylethoxy)phenyl]boronic acid, (4-Fluoro-2-isopropoxyphenyl)boronic acid(contains varying amounts of anhydride)