Products 1451390-94-5
CAS 1451390-94-5 appears in our catalog under these names: 4-Fluoro-3-isopropoxyphenylboronic acid, 95%, (4-Fluoro-3-isopropoxyphenyl)boronic acid, 98+%, (4-Fluoro-3-isopropoxyphenyl)boronic acid, 95%, (4-Fluoro-3-isopropoxyphenyl)boronic acid, ≥99.7%, 4-Fluoro-3-isopropoxyphenylboronic acid, ≥99.7%. Offered by: Combi-blocks, AmBeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(4-fluoro-3-propan-2-yloxyphenyl)boronic acid (CAS 1451390-94-5) is a chemical compound with the molecular formula C9H12BFO3 and a molecular weight of 198.00 g/mol. IUPAC name: (4-fluoro-3-propan-2-yloxyphenyl)boronic acid. InChIKey: MKRGSEQMUWEXSB-UHFFFAOYSA-N.
| Molecular formula | C9H12BFO3 |
|---|---|
| Molecular weight | 198.00 g/mol |
| IUPAC name | (4-fluoro-3-propan-2-yloxyphenyl)boronic acid |
| InChIKey | MKRGSEQMUWEXSB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)OC(C)C)(O)O |
Computed by PubChem (NCBI)