cas: 169944-04-1 — see every product listed under this CAS number, including other names
(4-Phenoxyphenyl)methanamine hydrochloride 98% (CAS 169944-04-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A687355-250mg |
| cas | 169944-04-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 509.44 Pln | |
| Ambeed | 10g | 654.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A687355 |
(4-phenoxyphenyl)methanamine;hydrochloride (CAS 169944-04-1) is a chemical compound with the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. IUPAC name: (4-phenoxyphenyl)methanamine;hydrochloride. InChIKey: VHCSCKHIGGFTHN-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | (4-phenoxyphenyl)methanamine;hydrochloride |
| InChIKey | VHCSCKHIGGFTHN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)