CAS 31963-35-6 appears in our catalog under these names: 1-(2-Phenoxyphenyl)methanamine hydrochloride, 98%, 1-(2-Phenoxyphenyl)methanamine hydrochloride, 97% , 1-(2-Phenoxyphenyl)methanamine hydrochloride 95%, 1-(2-Phenoxyphenyl)methanamine hydrochloride, 95%, 95%, 1-(2-Phenoxyphenyl)methanamine hydrochloride, 95%. Offered by: Combi-blocks, Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 250MG, 100mg.
(2-phenoxyphenyl)methanamine;hydrochloride (CAS 31963-35-6) is a chemical compound with the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. IUPAC name: (2-phenoxyphenyl)methanamine;hydrochloride. InChIKey: USRYZTSPSJXQFU-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | (2-phenoxyphenyl)methanamine;hydrochloride |
| InChIKey | USRYZTSPSJXQFU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2CN.Cl |
Computed by PubChem (NCBI)