CAS 376637-85-3 appears in our catalog under these names: 3-Phenoxybenzylamine hydrochloride, 95%, 3-Phenoxybenzylamine hydrochloride, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 1g, 5g.
(3-phenoxyphenyl)methanamine;hydrochloride (CAS 376637-85-3) is a chemical compound with the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. IUPAC name: (3-phenoxyphenyl)methanamine;hydrochloride. InChIKey: WMFHUUKYIUOHRA-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | (3-phenoxyphenyl)methanamine;hydrochloride |
| InChIKey | WMFHUUKYIUOHRA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)CN.Cl |
Computed by PubChem (NCBI)