CAS 13219-33-5 is the registry number for 4'-Methoxy-biphenyl-4-ylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
4-(4-methoxyphenyl)aniline;hydrochloride (CAS 13219-33-5) is a chemical compound with the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. IUPAC name: 4-(4-methoxyphenyl)aniline;hydrochloride. InChIKey: UJPYPOQXKPUALV-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)aniline;hydrochloride |
| InChIKey | UJPYPOQXKPUALV-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)