CAS 811842-36-1 appears in our catalog under these names: 3-(3-Methoxyphenyl)aniline hydrochloride, 98%, 3'-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride, 98%, 98%, 3'-Methoxybiphenyl-3-ylamine hydrochloride. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg.
3-(3-methoxyphenyl)aniline;hydrochloride (CAS 811842-36-1) is a chemical compound with the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. IUPAC name: 3-(3-methoxyphenyl)aniline;hydrochloride. InChIKey: DXSJOFVGCVBEEK-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | 3-(3-methoxyphenyl)aniline;hydrochloride |
| InChIKey | DXSJOFVGCVBEEK-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC(=CC=C2)N.Cl |
Computed by PubChem (NCBI)