CAS 107624-16-8 appears in our catalog under these names: 5-methoxy-2-phenylaniline hydrochloride, 95%, 5-Methoxy-2-phenylaniline hydrochloride, 98%, 98%, 6-Phenyl-m-anisidine hydrochloride, 95+%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
5-methoxy-2-phenylaniline;hydrochloride (CAS 107624-16-8) is a chemical compound with the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. IUPAC name: 5-methoxy-2-phenylaniline;hydrochloride. InChIKey: BJOOGZLAYZGSRZ-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | 5-methoxy-2-phenylaniline;hydrochloride |
| InChIKey | BJOOGZLAYZGSRZ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)