CAS 169944-04-1 appears in our catalog under these names: (4-Phenoxyphenyl)methanamine hydrochloride, 98%, (4-Phenoxyphenyl)methanamine hydrochloride, (4-Phenoxyphenyl)methylamine hydrochloride, 97% , (4-Phenoxyphenyl)methanamine hydrochloride 98%, (4-Phenoxyphenyl)methanamine hydrochloride, 98%, 98%. Offered by: Combi-blocks, Biosynth, Thermo Scientific, Ambeed, Chemat. Available pack sizes: 10g, 1g, 25g, 5g, 250mg.
(4-phenoxyphenyl)methanamine;hydrochloride (CAS 169944-04-1) is a chemical compound with the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. IUPAC name: (4-phenoxyphenyl)methanamine;hydrochloride. InChIKey: VHCSCKHIGGFTHN-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | (4-phenoxyphenyl)methanamine;hydrochloride |
| InChIKey | VHCSCKHIGGFTHN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)