Products 1134334-65-8
CAS 1134334-65-8 appears in our catalog under these names: 2-Chloro-1-(1,2,5-trimethyl-1h-indol-3-yl)ethanone, 95%, 2-Chloro-1-(1,2,5-trimethyl-1H-indol-3-yl)ethanone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 1000mg, 500mg, 2000mg, 5000mg.
2-chloro-1-(1,2,5-trimethylindol-3-yl)ethanone (CAS 1134334-65-8) is a chemical compound with the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. IUPAC name: 2-chloro-1-(1,2,5-trimethylindol-3-yl)ethanone. InChIKey: FNQWKKOZUUPLFQ-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | 2-chloro-1-(1,2,5-trimethylindol-3-yl)ethanone |
| InChIKey | FNQWKKOZUUPLFQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(C(=C2C(=O)CCl)C)C |
Computed by PubChem (NCBI)