cas: 873842-06-9 — see every product listed under this CAS number, including other names
(4R)-Fmoc-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid, 98% (CAS 873842-06-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F494428-250MG |
| cas | 873842-06-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 534.20 Pln | |
| Fluorochem | 5g | 2033.68 Pln | |
| Fluorochem | 10g | 4006.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(4R)-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid (CAS 873842-06-9) is a chemical compound with the molecular formula C21H21NO4S and a molecular weight of 383.5 g/mol. IUPAC name: (4R)-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid. InChIKey: UPFXVBZXMLAMDX-SFHVURJKSA-N.
| Molecular formula | C21H21NO4S |
|---|---|
| Molecular weight | 383.5 g/mol |
| IUPAC name | (4R)-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | UPFXVBZXMLAMDX-SFHVURJKSA-N |
| SMILES | CC1(N([C@@H](CS1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C |
Computed by PubChem (NCBI)