Fmoc-L-Thz(Me2)-OH, 98%, 98%
cas: 873842-06-9 — see every product listed under this CAS number, including other names
Fmoc-L-Thz(Me2)-OH, 98%, 98% (CAS 873842-06-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GV9X-100mg |
| cas | 873842-06-9 |
| size | 100mg |
| availability | 15g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 501.20 Pln | |
| Chemat | 5g | 1922.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4R)-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid (CAS 873842-06-9) is a chemical compound with the molecular formula C21H21NO4S and a molecular weight of 383.5 g/mol. IUPAC name: (4R)-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid. InChIKey: UPFXVBZXMLAMDX-SFHVURJKSA-N.
| Molecular formula | C21H21NO4S |
|---|---|
| Molecular weight | 383.5 g/mol |
| IUPAC name | (4R)-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | UPFXVBZXMLAMDX-SFHVURJKSA-N |
| SMILES | CC1(N([C@@H](CS1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C |
Computed by PubChem (NCBI)