cas: 488713-34-4 — see every product listed under this CAS number, including other names
(5-Fluoro-2-(methoxymethoxy)phenyl)boronic acid, 97%, 97% (CAS 488713-34-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BXY-250mg |
| cas | 488713-34-4 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 602.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[5-fluoro-2-(methoxymethoxy)phenyl]boronic acid (CAS 488713-34-4) is a chemical compound with the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. IUPAC name: [5-fluoro-2-(methoxymethoxy)phenyl]boronic acid. InChIKey: AMHIODVERFMLIU-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO4 |
|---|---|
| Molecular weight | 199.97 g/mol |
| IUPAC name | [5-fluoro-2-(methoxymethoxy)phenyl]boronic acid |
| InChIKey | AMHIODVERFMLIU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)OCOC)(O)O |
Computed by PubChem (NCBI)