cas: 20033-99-2 — see every product listed under this CAS number, including other names
(5-Methoxy-1H-benzoimidazol-2-yl)-methanol, 97% (CAS 20033-99-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F025277-100MG |
| cas | 20033-99-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 112.48 Pln | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 5g | 560.24 Pln | |
| Fluorochem | 10g | 1060.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(6-methoxy-1H-benzimidazol-2-yl)methanol (CAS 20033-99-2) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: (6-methoxy-1H-benzimidazol-2-yl)methanol. InChIKey: VFKGGGIPGOQNRO-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | (6-methoxy-1H-benzimidazol-2-yl)methanol |
| InChIKey | VFKGGGIPGOQNRO-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(N2)CO |
Computed by PubChem (NCBI)