cas: 20033-99-2 — see every product listed under this CAS number, including other names
2-(Hydroxymethyl)-5-methoxybenzimidazole 97% (CAS 20033-99-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A806683-250mg |
| cas | 20033-99-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 298.06 Pln | |
| Ambeed | 5g | 615.13 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A806683 |
(6-methoxy-1H-benzimidazol-2-yl)methanol (CAS 20033-99-2) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: (6-methoxy-1H-benzimidazol-2-yl)methanol. InChIKey: VFKGGGIPGOQNRO-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | (6-methoxy-1H-benzimidazol-2-yl)methanol |
| InChIKey | VFKGGGIPGOQNRO-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(N2)CO |
Computed by PubChem (NCBI)