cas: 867333-04-8 — see every product listed under this CAS number, including other names
(6-Chloro-2-fluoro-3-methoxyphenyl)boronic acid 98% (CAS 867333-04-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A614079-50mg |
| cas | 867333-04-8 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 153.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A614079 |
(6-chloro-2-fluoro-3-methoxyphenyl)boronic acid (CAS 867333-04-8) is a chemical compound with the molecular formula C7H7BClFO3 and a molecular weight of 204.39 g/mol. IUPAC name: (6-chloro-2-fluoro-3-methoxyphenyl)boronic acid. InChIKey: CVKDGGIRBCXOSZ-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO3 |
|---|---|
| Molecular weight | 204.39 g/mol |
| IUPAC name | (6-chloro-2-fluoro-3-methoxyphenyl)boronic acid |
| InChIKey | CVKDGGIRBCXOSZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)OC)Cl)(O)O |
Computed by PubChem (NCBI)