6-Chloro-2-fluoro-3-methoxyphenylboronic acid
cas: 867333-04-8 — see every product listed under this CAS number, including other names
6-Chloro-2-fluoro-3-methoxyphenylboronic acid (CAS 867333-04-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 25g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119F8Z-250mg |
| cas | 867333-04-8 |
| size | 250mg |
| availability | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 25g | 2541.20 Pln | |
| Chemat | 5g | 784.40 Pln |
properties
| delivery time | 3 weeks |
|---|
(6-chloro-2-fluoro-3-methoxyphenyl)boronic acid (CAS 867333-04-8) is a chemical compound with the molecular formula C7H7BClFO3 and a molecular weight of 204.39 g/mol. IUPAC name: (6-chloro-2-fluoro-3-methoxyphenyl)boronic acid. InChIKey: CVKDGGIRBCXOSZ-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO3 |
|---|---|
| Molecular weight | 204.39 g/mol |
| IUPAC name | (6-chloro-2-fluoro-3-methoxyphenyl)boronic acid |
| InChIKey | CVKDGGIRBCXOSZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)OC)Cl)(O)O |
Computed by PubChem (NCBI)