cas: 475160-83-9 — see every product listed under this CAS number, including other names
(9H-Fluoren-9-yl)methyl (4-(hydroxymethyl)phenyl)carbamate, 98% (CAS 475160-83-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F462985-100MG |
| cas | 475160-83-9 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 169.75 Pln | |
| Fluorochem | 250mg | 242.64 Pln | |
| Fluorochem | 1g | 768.50 Pln | |
| Fluorochem | 5g | 2392.93 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1370.00 Pln | |
| Chemat | 10g | 2334.80 Pln | |
| Chemat | 25g | 4542.80 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
9H-fluoren-9-ylmethyl N-[4-(hydroxymethyl)phenyl]carbamate (CAS 475160-83-9) is a chemical compound with the molecular formula C22H19NO3 and a molecular weight of 345.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[4-(hydroxymethyl)phenyl]carbamate. InChIKey: AMCNVVZGRKIDRW-UHFFFAOYSA-N.
| Molecular formula | C22H19NO3 |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[4-(hydroxymethyl)phenyl]carbamate |
| InChIKey | AMCNVVZGRKIDRW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=C(C=C4)CO |
Computed by PubChem (NCBI)