CAS 6248-41-5 is the registry number for N-(3-Acetylphenyl)-3-(benzyloxy)benzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-acetylphenyl)-3-phenylmethoxybenzamide (CAS 6248-41-5) is a chemical compound with the molecular formula C22H19NO3 and a molecular weight of 345.4 g/mol. IUPAC name: N-(3-acetylphenyl)-3-phenylmethoxybenzamide. InChIKey: NGFYDEDEFPFWRT-UHFFFAOYSA-N.
| Molecular formula | C22H19NO3 |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | N-(3-acetylphenyl)-3-phenylmethoxybenzamide |
| InChIKey | NGFYDEDEFPFWRT-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)NC(=O)C2=CC(=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)