CAS 104599-10-2 appears in our catalog under these names: Bazedoxifene Impurity 3, Des(1-azepanyl)ethyl Bazedoxifene, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
2-(4-hydroxyphenyl)-1-[(4-hydroxyphenyl)methyl]-3-methylindol-5-ol (CAS 104599-10-2) is a chemical compound with the molecular formula C22H19NO3 and a molecular weight of 345.4 g/mol. IUPAC name: 2-(4-hydroxyphenyl)-1-[(4-hydroxyphenyl)methyl]-3-methylindol-5-ol. InChIKey: JPMOCTUKPAGCTC-UHFFFAOYSA-N.
| Molecular formula | C22H19NO3 |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)-1-[(4-hydroxyphenyl)methyl]-3-methylindol-5-ol |
| InChIKey | JPMOCTUKPAGCTC-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C2=C1C=C(C=C2)O)CC3=CC=C(C=C3)O)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)