CAS 206537-33-9 is the registry number for (9H-Fluoren-9-yl)methyl (3-(hydroxymethyl)phenyl)carbamate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
9H-fluoren-9-ylmethyl N-[3-(hydroxymethyl)phenyl]carbamate (CAS 206537-33-9) is a chemical compound with the molecular formula C22H19NO3 and a molecular weight of 345.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[3-(hydroxymethyl)phenyl]carbamate. InChIKey: OPZBGQHNOLPTMF-UHFFFAOYSA-N.
| Molecular formula | C22H19NO3 |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[3-(hydroxymethyl)phenyl]carbamate |
| InChIKey | OPZBGQHNOLPTMF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=CC(=C4)CO |
Computed by PubChem (NCBI)