CAS 228414-55-9 is the registry number for N-4-(1-Pyrene)butyroylglycine. Offered by: TRC. Available pack sizes: 50mg.
2-(4-pyren-1-ylbutanoylamino)acetic acid (CAS 228414-55-9) is a chemical compound with the molecular formula C22H19NO3 and a molecular weight of 345.4 g/mol. IUPAC name: 2-(4-pyren-1-ylbutanoylamino)acetic acid. InChIKey: ZYPJIZQPSJBSOH-UHFFFAOYSA-N.
| Molecular formula | C22H19NO3 |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | 2-(4-pyren-1-ylbutanoylamino)acetic acid |
| InChIKey | ZYPJIZQPSJBSOH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)CCCC(=O)NCC(=O)O |
Computed by PubChem (NCBI)