Products 2097024-37-6
CAS 2097024-37-6 appears in our catalog under these names: UGT1A1–IN–1, UGT1A1-IN-1, 99.27%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 100 mg, 10mM/1mL, 50 mg.
2-butyl-6-(4-hydroxyphenyl)benzo[de]isoquinoline-1,3-dione (CAS 2097024-37-6) is a chemical compound with the molecular formula C22H19NO3 and a molecular weight of 345.4 g/mol. IUPAC name: 2-butyl-6-(4-hydroxyphenyl)benzo[de]isoquinoline-1,3-dione. InChIKey: JRXIYIQGSHSLMX-UHFFFAOYSA-N.
| Molecular formula | C22H19NO3 |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | 2-butyl-6-(4-hydroxyphenyl)benzo[de]isoquinoline-1,3-dione |
| InChIKey | JRXIYIQGSHSLMX-UHFFFAOYSA-N |
| SMILES | CCCCN1C(=O)C2=C3C(=C(C=C2)C4=CC=C(C=C4)O)C=CC=C3C1=O |
Computed by PubChem (NCBI)