CAS 380342-08-5 is the registry number for 4-(4-Methoxybenzylidene)-1,2,3,4-tetrahydroacridine-9-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(4Z)-4-[(4-methoxyphenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylic acid (CAS 380342-08-5) is a chemical compound with the molecular formula C22H19NO3 and a molecular weight of 345.4 g/mol. IUPAC name: (4Z)-4-[(4-methoxyphenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylic acid. InChIKey: AMSBESPIMWAFGZ-SQFISAMPSA-N.
| Molecular formula | C22H19NO3 |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | (4Z)-4-[(4-methoxyphenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylic acid |
| InChIKey | AMSBESPIMWAFGZ-SQFISAMPSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C\2/CCCC3=C(C4=CC=CC=C4N=C23)C(=O)O |
Computed by PubChem (NCBI)