CAS 202805-26-3 is the registry number for (2R)-[(Diphenylacetyl)amino](phenyl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2R)-2-[(2,2-diphenylacetyl)amino]-2-phenylacetic acid (CAS 202805-26-3) is a chemical compound with the molecular formula C22H19NO3 and a molecular weight of 345.4 g/mol. IUPAC name: (2R)-2-[(2,2-diphenylacetyl)amino]-2-phenylacetic acid. InChIKey: TUEBEFJSLZPNJI-HXUWFJFHSA-N.
| Molecular formula | C22H19NO3 |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | (2R)-2-[(2,2-diphenylacetyl)amino]-2-phenylacetic acid |
| InChIKey | TUEBEFJSLZPNJI-HXUWFJFHSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](C(=O)O)NC(=O)C(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)