cas: 106690-33-9 — see every product listed under this CAS number, including other names
(Benzo[1,3]dioxol-5-yloxy)-acetic acid, 98% (CAS 106690-33-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F059837-250MG |
| cas | 106690-33-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 1g | 581.06 Pln | |
| Fluorochem | 5g | 1903.51 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(1,3-benzodioxol-5-yloxy)acetic acid (CAS 106690-33-9) is a chemical compound with the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yloxy)acetic acid. InChIKey: OHPMDIAHFMBXQX-UHFFFAOYSA-N.
| Molecular formula | C9H8O5 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yloxy)acetic acid |
| InChIKey | OHPMDIAHFMBXQX-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)OCC(=O)O |
Computed by PubChem (NCBI)