CAS 106690-33-9 appears in our catalog under these names: (1,3-Benzodioxol-5-yloxy)acetic acid, 95%, 2-(Benzo[d][1,3]dioxol-5-yloxy)acetic acid, 98%, 98%, (Benzo[1,3]dioxol-5-yloxy)-acetic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 25g, 1g, 100mg.
2-(1,3-benzodioxol-5-yloxy)acetic acid (CAS 106690-33-9) is a chemical compound with the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yloxy)acetic acid. InChIKey: OHPMDIAHFMBXQX-UHFFFAOYSA-N.
| Molecular formula | C9H8O5 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yloxy)acetic acid |
| InChIKey | OHPMDIAHFMBXQX-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)OCC(=O)O |
Computed by PubChem (NCBI)