cas: 94977-52-3 — see every product listed under this CAS number, including other names
(E)-3-(2,4-Difluorophenyl)acrylic acid 98% (CAS 94977-52-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A372677-5g |
| cas | 94977-52-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 25g | 476.06 Pln | |
| Ambeed | 100g | 1371.62 Pln | |
| Ambeed | 1g | 175.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A372677 |
(E)-3-(2,4-difluorophenyl)prop-2-enoic acid (CAS 94977-52-3) is a chemical compound with the molecular formula C9H6F2O2 and a molecular weight of 184.14 g/mol. IUPAC name: (E)-3-(2,4-difluorophenyl)prop-2-enoic acid. InChIKey: PQDXPFJQTKGTFP-DUXPYHPUSA-N.
| Molecular formula | C9H6F2O2 |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | (E)-3-(2,4-difluorophenyl)prop-2-enoic acid |
| InChIKey | PQDXPFJQTKGTFP-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)