cas: 94977-52-3 — see every product listed under this CAS number, including other names
(E)-3-(2,4-Difluorophenyl)acrylic acid, 97%, 97% (CAS 94977-52-3) is a chemical reagent available from Chemat. Available pack sizes: 50g, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FSO-50g |
| cas | 94977-52-3 |
| size | 50g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 333.20 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 25g | 198.80 Pln | |
| Chemat | 100g | 597.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(E)-3-(2,4-difluorophenyl)prop-2-enoic acid (CAS 94977-52-3) is a chemical compound with the molecular formula C9H6F2O2 and a molecular weight of 184.14 g/mol. IUPAC name: (E)-3-(2,4-difluorophenyl)prop-2-enoic acid. InChIKey: PQDXPFJQTKGTFP-DUXPYHPUSA-N.
| Molecular formula | C9H6F2O2 |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | (E)-3-(2,4-difluorophenyl)prop-2-enoic acid |
| InChIKey | PQDXPFJQTKGTFP-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)