cas: 24393-52-0 — see every product listed under this CAS number, including other names
(E)-Ethyl 3-(4-chlorophenyl)acrylate, ≥97-<99% (CAS 24393-52-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC5154-97-99-25g |
| cas | 24393-52-0 |
| size | 25g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 25g | 5731.00 Pln | |
| Hoffman Fine Chemicals | 50g | 8984.80 Pln | |
| Hoffman Fine Chemicals | 100g | 14184.50 Pln | |
| Hoffman Fine Chemicals | 200g | 22510.40 Pln | |
| Hoffman Fine Chemicals | 300g | 30281.24 Pln | |
| Hoffman Fine Chemicals | 400g | 36278.44 Pln |
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
Ethyl (E)-3-(4-chlorophenyl)prop-2-enoate (CAS 24393-52-0) is a chemical compound with the molecular formula C11H11ClO2 and a molecular weight of 210.65 g/mol. IUPAC name: ethyl (E)-3-(4-chlorophenyl)prop-2-enoate. InChIKey: MHZFMMSRIDAQIB-VMPITWQZSA-N.
| Molecular formula | C11H11ClO2 |
|---|---|
| Molecular weight | 210.65 g/mol |
| IUPAC name | ethyl (E)-3-(4-chlorophenyl)prop-2-enoate |
| InChIKey | MHZFMMSRIDAQIB-VMPITWQZSA-N |
| SMILES | CCOC(=O)/C=C/C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)