cas: 24393-52-0 — see every product listed under this CAS number, including other names
Ethyl (2E)-3-(4-chlorophenyl)-2-propenoate, 98%, 98% (CAS 24393-52-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117VAN-250mg |
| cas | 24393-52-0 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 611.60 Pln | |
| Chemat | 25g | 2109.20 Pln | |
| Chemat | 100g | 5445.20 Pln | |
| Chemat | 100mg | 117.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl (E)-3-(4-chlorophenyl)prop-2-enoate (CAS 24393-52-0) is a chemical compound with the molecular formula C11H11ClO2 and a molecular weight of 210.65 g/mol. IUPAC name: ethyl (E)-3-(4-chlorophenyl)prop-2-enoate. InChIKey: MHZFMMSRIDAQIB-VMPITWQZSA-N.
| Molecular formula | C11H11ClO2 |
|---|---|
| Molecular weight | 210.65 g/mol |
| IUPAC name | ethyl (E)-3-(4-chlorophenyl)prop-2-enoate |
| InChIKey | MHZFMMSRIDAQIB-VMPITWQZSA-N |
| SMILES | CCOC(=O)/C=C/C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)