cas: 24393-52-0 — see every product listed under this CAS number, including other names
(E)-Ethyl 3-(4-chlorophenyl)acrylate, 95-<97% (CAS 24393-52-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC5154-95-97-25g |
| cas | 24393-52-0 |
| size | 25g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 25g | 4480.52 Pln | |
| Hoffman Fine Chemicals | 50g | 6981.48 Pln | |
| Hoffman Fine Chemicals | 100g | 10981.74 Pln | |
| Hoffman Fine Chemicals | 200g | 17387.26 Pln | |
| Hoffman Fine Chemicals | 300g | 23365.32 Pln | |
| Hoffman Fine Chemicals | 400g | 27978.06 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
Ethyl (E)-3-(4-chlorophenyl)prop-2-enoate (CAS 24393-52-0) is a chemical compound with the molecular formula C11H11ClO2 and a molecular weight of 210.65 g/mol. IUPAC name: ethyl (E)-3-(4-chlorophenyl)prop-2-enoate. InChIKey: MHZFMMSRIDAQIB-VMPITWQZSA-N.
| Molecular formula | C11H11ClO2 |
|---|---|
| Molecular weight | 210.65 g/mol |
| IUPAC name | ethyl (E)-3-(4-chlorophenyl)prop-2-enoate |
| InChIKey | MHZFMMSRIDAQIB-VMPITWQZSA-N |
| SMILES | CCOC(=O)/C=C/C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)