cas: 132696-45-8 — see every product listed under this CAS number, including other names
(R)–3–(Boc–amino)–2–methylpropionic acid (CAS 132696-45-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD15151-100mg |
| cas | 132696-45-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 714.05 Pln | |
| GLPBio | 250mg | 1013.60 Pln | |
| GLPBio | 500mg | 1374.00 Pln | |
| GLPBio | 50mg | 671.93 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2R)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 132696-45-8) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: (2R)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: GDQRNRYMFXDGMS-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (2R)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | GDQRNRYMFXDGMS-ZCFIWIBFSA-N |
| SMILES | C[C@H](CNC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)