cas: 132696-45-8 — see every product listed under this CAS number, including other names
(R)-3-(Boc-amino)-2-methylpropionic acid, 97%, 97% (CAS 132696-45-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11221V-50mg |
| cas | 132696-45-8 |
| size | 50mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 98.00 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1782.80 Pln | |
| Chemat | 10g | 3165.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 132696-45-8) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: (2R)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: GDQRNRYMFXDGMS-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (2R)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | GDQRNRYMFXDGMS-ZCFIWIBFSA-N |
| SMILES | C[C@H](CNC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)