cas: 1131737-05-7 — see every product listed under this CAS number, including other names
(R)-1-(2,6-Dichlorophenyl)ethanamine hydrochloride, 96% (CAS 1131737-05-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F318105-100MG |
| cas | 1131737-05-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 320.74 Pln | |
| Fluorochem | 250mg | 690.40 Pln | |
| Fluorochem | 1g | 2476.23 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
(1R)-1-(2,6-dichlorophenyl)ethanamine;hydrochloride (CAS 1131737-05-7) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: (1R)-1-(2,6-dichlorophenyl)ethanamine;hydrochloride. InChIKey: QBWKCUFYMDZATP-NUBCRITNSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | (1R)-1-(2,6-dichlorophenyl)ethanamine;hydrochloride |
| InChIKey | QBWKCUFYMDZATP-NUBCRITNSA-N |
| SMILES | C[C@H](C1=C(C=CC=C1Cl)Cl)N.Cl |
Computed by PubChem (NCBI)