Products 2055848-81-0
CAS 2055848-81-0 appears in our catalog under these names: (S)-1-(2,6-Dichlorophenyl)ethanamine hydrochloride, 95%, (S)–1–(2，6–Dichlorophenyl)ethanamine hydrochloride, (S)-1-(2,6-Dichlorophenyl)ethanamine hydrochloride, 96%, 96%, (S)-1-(2,6-Dichlorophenyl)ethanamine hydrochloride, 96%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(1S)-1-(2,6-dichlorophenyl)ethanamine;hydrochloride (CAS 2055848-81-0) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: (1S)-1-(2,6-dichlorophenyl)ethanamine;hydrochloride. InChIKey: QBWKCUFYMDZATP-JEDNCBNOSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | (1S)-1-(2,6-dichlorophenyl)ethanamine;hydrochloride |
| InChIKey | QBWKCUFYMDZATP-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=C(C=CC=C1Cl)Cl)N.Cl |
Computed by PubChem (NCBI)