CAS 1982270-14-3 is the registry number for (R)-1-(2,6-Dichlorophenyl)ethanamine hydrochloride, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(1R)-1-(2,6-dichlorophenyl)ethanamine;hydrochloride (CAS 1982270-14-3) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: (1R)-1-(2,6-dichlorophenyl)ethanamine;hydrochloride. InChIKey: QBWKCUFYMDZATP-NUBCRITNSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | (1R)-1-(2,6-dichlorophenyl)ethanamine;hydrochloride |
| InChIKey | QBWKCUFYMDZATP-NUBCRITNSA-N |
| SMILES | C[C@H](C1=C(C=CC=C1Cl)Cl)N.Cl |
Computed by PubChem (NCBI)