CAS 1394838-53-9 is the registry number for 1-(2,6-Dichlorophenyl)ethanamine hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2,6-dichlorophenyl)ethanamine;hydrochloride (CAS 1394838-53-9) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: 1-(2,6-dichlorophenyl)ethanamine;hydrochloride. InChIKey: QBWKCUFYMDZATP-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | 1-(2,6-dichlorophenyl)ethanamine;hydrochloride |
| InChIKey | QBWKCUFYMDZATP-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC=C1Cl)Cl)N.Cl |
Computed by PubChem (NCBI)