Products 1394838-53-9

CAS 1394838-53-9 is the registry number for 1-(2,6-Dichlorophenyl)ethanamine hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(2,6-dichlorophenyl)ethanamine;hydrochloride (CAS 1394838-53-9) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: 1-(2,6-dichlorophenyl)ethanamine;hydrochloride. InChIKey: QBWKCUFYMDZATP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10Cl3N
Molecular weight226.5 g/mol
IUPAC name1-(2,6-dichlorophenyl)ethanamine;hydrochloride
InChIKeyQBWKCUFYMDZATP-UHFFFAOYSA-N
SMILESCC(C1=C(C=CC=C1Cl)Cl)N.Cl

Computed by PubChem (NCBI)