cas: 1212307-96-4 — see every product listed under this CAS number, including other names
(R)-1-(3,4-Dichlorophenyl)ethanamine hydrochloride, 97%, 97% (CAS 1212307-96-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 50mg, 100mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110ZNJ-250mg |
| cas | 1212307-96-4 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 501.20 Pln | |
| Chemat | 50mg | 208.40 Pln | |
| Chemat | 100mg | 304.40 Pln | |
| Chemat | 1g | 1394.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(1R)-1-(3,4-dichlorophenyl)ethanamine;hydrochloride (CAS 1212307-96-4) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: (1R)-1-(3,4-dichlorophenyl)ethanamine;hydrochloride. InChIKey: LTTRKULQEVDRNO-NUBCRITNSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | (1R)-1-(3,4-dichlorophenyl)ethanamine;hydrochloride |
| InChIKey | LTTRKULQEVDRNO-NUBCRITNSA-N |
| SMILES | C[C@H](C1=CC(=C(C=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)