CAS 1212307-96-4 appears in our catalog under these names: (1R)-1-(3,4-Dichlorophenyl)ethan-1-amine hydrochloride, 95%, (R)–1–(3,4–Dichlorophenyl)ethanamine hydrochloride, (R)-1-(3,4-Dichlorophenyl)ethanamine Hydrochloride, (R)-1-(3,4-Dichlorophenyl)ethanamine hydrochloride, 97%, 97%, (R)-1-(3,4-Dichlorophenyl)ethanamine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 5g, 1g, 2,5g, 50mg, 500mg, 2.5g.
(1R)-1-(3,4-dichlorophenyl)ethanamine;hydrochloride (CAS 1212307-96-4) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: (1R)-1-(3,4-dichlorophenyl)ethanamine;hydrochloride. InChIKey: LTTRKULQEVDRNO-NUBCRITNSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | (1R)-1-(3,4-dichlorophenyl)ethanamine;hydrochloride |
| InChIKey | LTTRKULQEVDRNO-NUBCRITNSA-N |
| SMILES | C[C@H](C1=CC(=C(C=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)