(R)-1-(4-(Trifluoromethyl)phenyl)ethanamine hydrochloride, 95%, 95%
cas: 856645-99-3 — see every product listed under this CAS number, including other names
(R)-1-(4-(Trifluoromethyl)phenyl)ethanamine hydrochloride, 95%, 95% (CAS 856645-99-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114C7Z-100mg |
| cas | 856645-99-3 |
| size | 100mg |
| availability | 2g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 438.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(1R)-1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 856645-99-3) is a chemical compound with the molecular formula C9H11ClF3N and a molecular weight of 225.64 g/mol. IUPAC name: (1R)-1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: JVLWNYKROJNLAS-FYZOBXCZSA-N.
| Molecular formula | C9H11ClF3N |
|---|---|
| Molecular weight | 225.64 g/mol |
| IUPAC name | (1R)-1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | JVLWNYKROJNLAS-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(1R)-1-[4-(trifluoromethyl)phenyl]ethan-1-amine hydrochloride, (1R)-1-(4-(trifluoromethyl)phenyl)ethan-1-amine hydrochloride, (R)-1-(4-(Trifluoromethyl)phenyl)ethanamine hydrochloride, (1R)-1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride, (R)-1-(4-(Trifluoromethyl)phenyl)ethanamine HCl, (r)-1-[4-(trifluoromethyl)phenyl]ethylamine hydrochloride, (R)-1-(4-(trifluoromethyl)phenyl)ethan-1-amine hydrochloride, (R)-1-[4-(Trifluoromethyl)phenyl]ethanamine Hydrochloride, (1R)-1-[4-(trifluoro, (R)-1-(4-(trifluoromethyl)phenyl)ethanaminehydrochloride